C19H22N6O — CID 95844018
2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-6-pyridin-3-yloxypyrazine (PubChem CID 95844018) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-6-pyridin-3-yloxypyrazine.
| Compound Name | 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-6-pyridin-3-yloxypyrazine |
|---|---|
| PubChem CID | 95844018 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-6-pyridin-3-yloxypyrazine |
| SMILES | Cn1ccnc1CN1CCC(c2cncc(Oc3cccnc3)n2)CC1 |
| InChI | InChI=1S/C19H22N6O/c1-24-10-7-22-18(24)14-25-8-4-15(5-9-25)17-12-21-13-19(23-17)26-16-3-2-6-20-11-16/h2-3,6-7,10-13,15H,4-5,8-9,14H2,1H3 |
| InChIKey | IEHSKTILVBDILW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |