C18H20FN3O — CID 110258535
2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]acetamide (PubChem CID 110258535) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]acetamide.
| Compound Name | 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110258535 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCC(c2cccc(-c3ccccc3F)n2)C1 |
| InChI | InChI=1S/C18H20FN3O/c19-15-7-2-1-6-14(15)17-9-3-8-16(21-17)13-5-4-10-22(11-13)12-18(20)23/h1-3,6-9,13H,4-5,10-12H2,(H2,20,23) |
| InChIKey | IKLQSUGMHWVEGU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |