C23H21F3N2O3S — CID 145433868
3-methoxy-4-[3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]phenyl]pyridine (PubChem CID 145433868) has the molecular formula C23H21F3N2O3S and a molecular weight of 462.49 g/mol. Its IUPAC name is 3-methoxy-4-[3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]phenyl]pyridine.
| Compound Name | 3-methoxy-4-[3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 145433868 |
| Molecular Formula | C23H21F3N2O3S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-methoxy-4-[3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]phenyl]pyridine |
| SMILES | COc1cnccc1-c1cccc(C2CCCN2S(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H21F3N2O3S/c1-31-22-15-27-11-10-20(22)16-5-2-6-17(13-16)21-9-4-12-28(21)32(29,30)19-8-3-7-18(14-19)23(24,25)26/h2-3,5-8,10-11,13-15,21H,4,9,12H2,1H3 |
| InChIKey | DNPPMHFFZOCKIF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |