C12H14F3N3O — CID 78202559
6-methyl-2-[3-(trifluoromethyl)anilino]-1,3-diazinan-4-one (PubChem CID 78202559) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 6-methyl-2-[3-(trifluoromethyl)anilino]-1,3-diazinan-4-one.
| Compound Name | 6-methyl-2-[3-(trifluoromethyl)anilino]-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78202559 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-methyl-2-[3-(trifluoromethyl)anilino]-1,3-diazinan-4-one |
| SMILES | CC1CC(=O)NC(Nc2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C12H14F3N3O/c1-7-5-10(19)18-11(16-7)17-9-4-2-3-8(6-9)12(13,14)15/h2-4,6-7,11,16-17H,5H2,1H3,(H,18,19) |
| InChIKey | AMJYNXHNSOIBRZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |