C12H10F3N — CID 102081817
N-cyclopenta-2,4-dien-1-yl-3-(trifluoromethyl)aniline (PubChem CID 102081817) has the molecular formula C12H10F3N and a molecular weight of 225.21 g/mol. Its IUPAC name is N-cyclopenta-2,4-dien-1-yl-3-(trifluoromethyl)aniline.
| Compound Name | N-cyclopenta-2,4-dien-1-yl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 102081817 |
| Molecular Formula | C12H10F3N |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-cyclopenta-2,4-dien-1-yl-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(NC2C=CC=C2)c1 |
| InChI | InChI=1S/C12H10F3N/c13-12(14,15)9-4-3-7-11(8-9)16-10-5-1-2-6-10/h1-8,10,16H |
| InChIKey | BZVFOVMHDGMPPH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |