C15H16F3NO3S — CID 71983148
N-(1,1-dioxothian-4-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 71983148) has the molecular formula C15H16F3NO3S and a molecular weight of 347.36 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71983148 |
| Molecular Formula | C15H16F3NO3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H16F3NO3S/c16-15(17,18)12-3-1-2-11(10-12)4-5-14(20)19-13-6-8-23(21,22)9-7-13/h1-5,10,13H,6-9H2,(H,19,20) |
| InChIKey | LFUOXIAWPUAQSQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|