C20H25F3N2O — CID 56569607
(E)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 56569607) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is (E)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56569607 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (E)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)/C=C/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H25F3N2O/c1-15(2)8-11-25-12-9-18(10-13-25)24-19(26)7-6-16-4-3-5-17(14-16)20(21,22)23/h3-8,14,18H,9-13H2,1-2H3,(H,24,26)/b7-6+ |
| InChIKey | DTHLYQJZGSQGKN-VOTSOKGWSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|