C22H23F3N2O — CID 139945871
(E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-4-[3-(trifluoromethyl)phenyl]but-3-enamide (PubChem CID 139945871) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-4-[3-(trifluoromethyl)phenyl]but-3-enamide.
| Compound Name | (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-4-[3-(trifluoromethyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 139945871 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-4-[3-(trifluoromethyl)phenyl]but-3-enamide |
| SMILES | O=C(C/C=C/c1cccc(C(F)(F)F)c1)N[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H23F3N2O/c23-22(24,25)19-10-4-8-17(14-19)9-5-11-21(28)26-20-12-13-27(16-20)15-18-6-2-1-3-7-18/h1-10,14,20H,11-13,15-16H2,(H,26,28)/b9-5+/t20-/m1/s1 |
| InChIKey | GBKYACMWTOLBSR-MVHVFESUSA-N |
| XLogP | 4.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |