C22H24Cl2N2O — CID 68884586
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-phenylbut-3-enamide (PubChem CID 68884586) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-phenylbut-3-enamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 68884586 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-phenylbut-3-enamide |
| SMILES | O=C(CC=Cc1ccccc1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl2N2O/c23-20-10-9-18(15-21(20)24)16-26-13-11-19(12-14-26)25-22(27)8-4-7-17-5-2-1-3-6-17/h1-7,9-10,15,19H,8,11-14,16H2,(H,25,27) |
| InChIKey | CMCLWCWCQNRUOD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |