C21H24Cl2N4O2 — CID 20794188
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-N'-pyridin-2-ylbutanediamide (PubChem CID 20794188) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-N'-pyridin-2-ylbutanediamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-N'-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 20794188 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-N'-pyridin-2-ylbutanediamide |
| SMILES | O=C(CCC(=O)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)Nc1ccccn1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c22-17-5-4-15(13-18(17)23)14-27-11-8-16(9-12-27)25-20(28)6-7-21(29)26-19-3-1-2-10-24-19/h1-5,10,13,16H,6-9,11-12,14H2,(H,25,28)(H,24,26,29) |
| InChIKey | WFBQRNDAHNPWCO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |