C18H26N2S — CID 81228662
N-(2-butan-2-ylsulfanyl-1-quinolin-6-ylethyl)propan-1-amine (PubChem CID 81228662) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is N-(2-butan-2-ylsulfanyl-1-quinolin-6-ylethyl)propan-1-amine.
| Compound Name | N-(2-butan-2-ylsulfanyl-1-quinolin-6-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 81228662 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-(2-butan-2-ylsulfanyl-1-quinolin-6-ylethyl)propan-1-amine |
| SMILES | CCCNC(CSC(C)CC)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H26N2S/c1-4-10-19-18(13-21-14(3)5-2)16-8-9-17-15(12-16)7-6-11-20-17/h6-9,11-12,14,18-19H,4-5,10,13H2,1-3H3 |
| InChIKey | KKMTWXABNDQSDJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |