C14H19N3 — CID 63967677
N-propyl-1-quinolin-6-ylethane-1,2-diamine (PubChem CID 63967677) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-propyl-1-quinolin-6-ylethane-1,2-diamine.
| Compound Name | N-propyl-1-quinolin-6-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63967677 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-propyl-1-quinolin-6-ylethane-1,2-diamine |
| SMILES | CCCNC(CN)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H19N3/c1-2-7-16-14(10-15)12-5-6-13-11(9-12)4-3-8-17-13/h3-6,8-9,14,16H,2,7,10,15H2,1H3 |
| InChIKey | QNBNLPQOQWPZEZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |