C13H14F3N3 — CID 65377807
1-quinolin-6-yl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 65377807) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-quinolin-6-yl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | 1-quinolin-6-yl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65377807 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-quinolin-6-yl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | NCC(NCC(F)(F)F)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)8-19-12(7-17)10-3-4-11-9(6-10)2-1-5-18-11/h1-6,12,19H,7-8,17H2 |
| InChIKey | HZYLRYAJSCHJAH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |