C23H19F3N4O3 — CID 54811786
2-[[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]amino]benzamide (PubChem CID 54811786) has the molecular formula C23H19F3N4O3 and a molecular weight of 456.42 g/mol. Its IUPAC name is 2-[[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]amino]benzamide.
| Compound Name | 2-[[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54811786 |
| Molecular Formula | C23H19F3N4O3 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NCC(=O)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H19F3N4O3/c24-23(25,26)15-6-4-8-17(12-15)30-22(33)14-5-3-7-16(11-14)29-20(31)13-28-19-10-2-1-9-18(19)21(27)32/h1-12,28H,13H2,(H2,27,32)(H,29,31)(H,30,33) |
| InChIKey | XESLSGFMCCAOBE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |