C8H11N3O4S — CID 112573308
2-[3-(sulfamoylamino)phenoxy]acetamide (PubChem CID 112573308) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-[3-(sulfamoylamino)phenoxy]acetamide.
| Compound Name | 2-[3-(sulfamoylamino)phenoxy]acetamide |
|---|---|
| PubChem CID | 112573308 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[3-(sulfamoylamino)phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H11N3O4S/c9-8(12)5-15-7-3-1-2-6(4-7)11-16(10,13)14/h1-4,11H,5H2,(H2,9,12)(H2,10,13,14) |
| InChIKey | HGQADANMKYKLPV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |