C10H12N2O6S — CID 43712925
2-[[3-(2-amino-2-oxoethoxy)phenyl]sulfamoyl]acetic acid (PubChem CID 43712925) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[[3-(2-amino-2-oxoethoxy)phenyl]sulfamoyl]acetic acid.
| Compound Name | 2-[[3-(2-amino-2-oxoethoxy)phenyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43712925 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[[3-(2-amino-2-oxoethoxy)phenyl]sulfamoyl]acetic acid |
| SMILES | NC(=O)COc1cccc(NS(=O)(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C10H12N2O6S/c11-9(13)5-18-8-3-1-2-7(4-8)12-19(16,17)6-10(14)15/h1-4,12H,5-6H2,(H2,11,13)(H,14,15) |
| InChIKey | IODZJPOYJUGMFP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |