methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate

C11H15NO7S2 — CID 82833635

IUPACmethyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate
SMILESCOC(=O)COc1cccc(NS(=O)(=O)CS(C)(=O)=O)c1
InChIInChI=1S/C11H15NO7S2/c1-18-11(13)7-19-10-5-3-4-9(6-10)12-21(16,17)8-20(2,14)15/h3-6,12H,7-8H2,1-2H3
InChIKeyNCGUSQDVAOVRLT-UHFFFAOYSA-N
MW337.38 g/mol
LogP-0.02
Rot. Bonds7

About methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate

methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate (PubChem CID 82833635) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate
PubChem CID82833635
Molecular FormulaC11H15NO7S2
Molecular Weight337.38 g/mol
Exact Mass337.03
IUPAC Namemethyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate
SMILESCOC(=O)COc1cccc(NS(=O)(=O)CS(C)(=O)=O)c1
InChIInChI=1S/C11H15NO7S2/c1-18-11(13)7-19-10-5-3-4-9(6-10)12-21(16,17)8-20(2,14)15/h3-6,12H,7-8H2,1-2H3
InChIKeyNCGUSQDVAOVRLT-UHFFFAOYSA-N
XLogP-0.02
TPSA115.84 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.38
LogP ≤ 5-0.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate?
The IUPAC name of methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate (CID 82833635) is methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate.
What is the SMILES notation for methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate?
The canonical SMILES for methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate is COC(=O)COc1cccc(NS(=O)(=O)CS(C)(=O)=O)c1.
What is the InChIKey of methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate?
The InChIKey is NCGUSQDVAOVRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO7S2/c1-18-11(13)7-19-10-5-3-4-9(6-10)12-21(16,17)8-20(2,14)15/h3-6,12H,7-8H2,1-2H3.
What are the key properties of methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate?
methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate has a molecular weight of 337.38 g/mol, XLogP of -0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(methylsulfonylmethylsulfonylamino)phenoxy]acetate is sourced from PubChem (CID 82833635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).