C9H11F3N2O — CID 171121684
1-N,1-N-dimethyl-4-(trifluoromethoxy)benzene-1,2-diamine (PubChem CID 171121684) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-(trifluoromethoxy)benzene-1,2-diamine.
| Compound Name | 1-N,1-N-dimethyl-4-(trifluoromethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 171121684 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-N,1-N-dimethyl-4-(trifluoromethoxy)benzene-1,2-diamine |
| SMILES | CN(C)c1ccc(OC(F)(F)F)cc1N |
| InChI | InChI=1S/C9H11F3N2O/c1-14(2)8-4-3-6(5-7(8)13)15-9(10,11)12/h3-5H,13H2,1-2H3 |
| InChIKey | JNCHOLAPORCTNI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|