C9H9F3INO — CID 118830517
2-iodo-N,N-dimethyl-5-(trifluoromethoxy)aniline (PubChem CID 118830517) has the molecular formula C9H9F3INO and a molecular weight of 331.08 g/mol. Its IUPAC name is 2-iodo-N,N-dimethyl-5-(trifluoromethoxy)aniline.
| Compound Name | 2-iodo-N,N-dimethyl-5-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 118830517 |
| Molecular Formula | C9H9F3INO |
| Molecular Weight | 331.08 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2-iodo-N,N-dimethyl-5-(trifluoromethoxy)aniline |
| SMILES | CN(C)c1cc(OC(F)(F)F)ccc1I |
| InChI | InChI=1S/C9H9F3INO/c1-14(2)8-5-6(3-4-7(8)13)15-9(10,11)12/h3-5H,1-2H3 |
| InChIKey | DJNHNTUNPROXIW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|