C16H17F3N2O4 — CID 119204049
4-methyl-4-[[6-(trifluoromethoxy)-1H-indole-2-carbonyl]amino]pentanoic acid (PubChem CID 119204049) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is 4-methyl-4-[[6-(trifluoromethoxy)-1H-indole-2-carbonyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[6-(trifluoromethoxy)-1H-indole-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119204049 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-methyl-4-[[6-(trifluoromethoxy)-1H-indole-2-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1cc2ccc(OC(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C16H17F3N2O4/c1-15(2,6-5-13(22)23)21-14(24)12-7-9-3-4-10(8-11(9)20-12)25-16(17,18)19/h3-4,7-8,20H,5-6H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | UMFDTNJROOFWSI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |