C20H17F4N3O3 — CID 86874853
N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6-(trifluoromethoxy)-1H-indole-2-carboxamide (PubChem CID 86874853) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6-(trifluoromethoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6-(trifluoromethoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 86874853 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6-(trifluoromethoxy)-1H-indole-2-carboxamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCNC(=O)c1cc2ccc(OC(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C20H17F4N3O3/c21-14-3-1-2-12(8-14)9-18(28)25-6-7-26-19(29)17-10-13-4-5-15(11-16(13)27-17)30-20(22,23)24/h1-5,8,10-11,27H,6-7,9H2,(H,25,28)(H,26,29) |
| InChIKey | RYVXHRLNTQTIRA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|