C16H13F4NO2 — CID 46474447
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-hydroxy-5-methylbenzamide (PubChem CID 46474447) has the molecular formula C16H13F4NO2 and a molecular weight of 327.28 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 46474447 |
| Molecular Formula | C16H13F4NO2 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)NCc2ccc(F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F4NO2/c1-9-2-5-14(22)12(6-9)15(23)21-8-10-3-4-11(17)7-13(10)16(18,19)20/h2-7,22H,8H2,1H3,(H,21,23) |
| InChIKey | AHJVBTPKNJLUPT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |