About N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide (PubChem CID 72689731) has the molecular formula C15H17F4NO
and a molecular weight of 303.30 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide |
| PubChem CID | 72689731 |
| Molecular Formula | C15H17F4NO |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)C=CC(=O)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F4NO/c1-14(2,3)7-6-13(21)20-9-10-4-5-11(16)8-12(10)15(17,18)19/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | MLYLNZWUDXCKGW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide?
The IUPAC name of N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide (CID 72689731) is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide.
What is the SMILES notation for N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide?
The canonical SMILES for N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide is CC(C)(C)C=CC(=O)NCc1ccc(F)cc1C(F)(F)F.
What is the InChIKey of N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide?
The InChIKey is MLYLNZWUDXCKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F4NO/c1-14(2,3)7-6-13(21)20-9-10-4-5-11(16)8-12(10)15(17,18)19/h4-8H,9H2,1-3H3,(H,20,21).
What are the key properties of N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide?
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide has a molecular weight of 303.30 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide is sourced from PubChem (CID 72689731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).