C15H17F4NO — CID 72689731
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide (PubChem CID 72689731) has the molecular formula C15H17F4NO and a molecular weight of 303.30 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 72689731 |
| Molecular Formula | C15H17F4NO |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)C=CC(=O)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F4NO/c1-14(2,3)7-6-13(21)20-9-10-4-5-11(16)8-12(10)15(17,18)19/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | MLYLNZWUDXCKGW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|