C14H18F4N2O — CID 78880942
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-pentan-3-ylurea (PubChem CID 78880942) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-pentan-3-ylurea.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 78880942 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F4N2O/c1-3-11(4-2)20-13(21)19-8-9-5-6-10(15)7-12(9)14(16,17)18/h5-7,11H,3-4,8H2,1-2H3,(H2,19,20,21) |
| InChIKey | GYMDXDUGEDYAGL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |