C17H18ClNO — CID 8751575
N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dimethylbenzamide (PubChem CID 8751575) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 8751575 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@H](C)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C17H18ClNO/c1-11-5-4-6-16(12(11)2)17(20)19-13(3)14-7-9-15(18)10-8-14/h4-10,13H,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | ISTSBYZKYGARHN-CYBMUJFWSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |