C13H15NO — CID 114389941
N-but-3-yn-2-yl-2,3-dimethylbenzamide (PubChem CID 114389941) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,3-dimethylbenzamide.
| Compound Name | N-but-3-yn-2-yl-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 114389941 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-but-3-yn-2-yl-2,3-dimethylbenzamide |
| SMILES | C#CC(C)NC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C13H15NO/c1-5-10(3)14-13(15)12-8-6-7-9(2)11(12)4/h1,6-8,10H,2-4H3,(H,14,15) |
| InChIKey | PVWFECRYUZSUQD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|