C14H13ClN2O2 — CID 25443183
N-[(1R)-1-(4-chlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 25443183) has the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25443183 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc[nH]c1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN2O2/c1-9(10-4-6-11(15)7-5-10)17-14(19)12-3-2-8-16-13(12)18/h2-9H,1H3,(H,16,18)(H,17,19)/t9-/m1/s1 |
| InChIKey | PANBEBPAYIPRGV-SECBINFHSA-N |
| XLogP | 2.52 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |