C17H18ClFN2O5S — CID 24659660
3-chloro-4-ethoxy-N-[4-fluoro-3-(methanesulfonamido)phenyl]-5-methoxybenzamide (PubChem CID 24659660) has the molecular formula C17H18ClFN2O5S and a molecular weight of 416.86 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[4-fluoro-3-(methanesulfonamido)phenyl]-5-methoxybenzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[4-fluoro-3-(methanesulfonamido)phenyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 24659660 |
| Molecular Formula | C17H18ClFN2O5S |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[4-fluoro-3-(methanesulfonamido)phenyl]-5-methoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc(F)c(NS(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C17H18ClFN2O5S/c1-4-26-16-12(18)7-10(8-15(16)25-2)17(22)20-11-5-6-13(19)14(9-11)21-27(3,23)24/h5-9,21H,4H2,1-3H3,(H,20,22) |
| InChIKey | BSLMMAUPMHIUBW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |