C19H24N2O4S — CID 109065384
N-(2-methoxyphenyl)-3-(pentylsulfamoyl)benzamide (PubChem CID 109065384) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-(pentylsulfamoyl)benzamide.
| Compound Name | N-(2-methoxyphenyl)-3-(pentylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 109065384 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(2-methoxyphenyl)-3-(pentylsulfamoyl)benzamide |
| SMILES | CCCCCNS(=O)(=O)c1cccc(C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-3-4-7-13-20-26(23,24)16-10-8-9-15(14-16)19(22)21-17-11-5-6-12-18(17)25-2/h5-6,8-12,14,20H,3-4,7,13H2,1-2H3,(H,21,22) |
| InChIKey | BLGBZZSDDOTBOV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|