C16H17FN2O4S — CID 33069732
3-(ethylsulfamoyl)-N-(4-fluoro-2-methoxyphenyl)benzamide (PubChem CID 33069732) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-(4-fluoro-2-methoxyphenyl)benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-(4-fluoro-2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 33069732 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-(4-fluoro-2-methoxyphenyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)Nc2ccc(F)cc2OC)c1 |
| InChI | InChI=1S/C16H17FN2O4S/c1-3-18-24(21,22)13-6-4-5-11(9-13)16(20)19-14-8-7-12(17)10-15(14)23-2/h4-10,18H,3H2,1-2H3,(H,19,20) |
| InChIKey | CTZAUDOMCLDMOI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |