C17H17F3N2O5S — CID 24536388
N-(2,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethylsulfamoyl)benzamide (PubChem CID 24536388) has the molecular formula C17H17F3N2O5S and a molecular weight of 418.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethylsulfamoyl)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24536388 |
| Molecular Formula | C17H17F3N2O5S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethylsulfamoyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(S(=O)(=O)NCC(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C17H17F3N2O5S/c1-26-12-6-7-14(15(9-12)27-2)22-16(23)11-4-3-5-13(8-11)28(24,25)21-10-17(18,19)20/h3-9,21H,10H2,1-2H3,(H,22,23) |
| InChIKey | YIEGAKBXWRVJQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |