C14H18N2O8 — CID 70623675
3-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-5-nitrobenzoic acid (PubChem CID 70623675) has the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-5-nitrobenzoic acid.
| Compound Name | 3-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 70623675 |
| Molecular Formula | C14H18N2O8 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-5-nitrobenzoic acid |
| SMILES | COCCOCCOCC(=O)Nc1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N2O8/c1-22-2-3-23-4-5-24-9-13(17)15-11-6-10(14(18)19)7-12(8-11)16(20)21/h6-8H,2-5,9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | MXZAGPHRGXERTE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|