C13H17N3O6 — CID 119725247
methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-5-nitrobenzoate (PubChem CID 119725247) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-5-nitrobenzoate.
| Compound Name | methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 119725247 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-5-nitrobenzoate |
| SMILES | COCCNCC(=O)Nc1cc(C(=O)OC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O6/c1-21-4-3-14-8-12(17)15-10-5-9(13(18)22-2)6-11(7-10)16(19)20/h5-7,14H,3-4,8H2,1-2H3,(H,15,17) |
| InChIKey | PCWSUVSQRRHZTH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|