C11H13N3O5 — CID 7262326
[(2S)-1-amino-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7262326) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7262326 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)O[C@@H](C)C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O5/c1-6(10(12)15)19-11(16)7-3-4-8(13-2)9(5-7)14(17)18/h3-6,13H,1-2H3,(H2,12,15)/t6-/m0/s1 |
| InChIKey | CMSRCBCZSJNNJH-LURJTMIESA-N |
| XLogP | 0.67 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|