C11H12N2O5S — CID 7678346
[(2R)-1-amino-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7678346) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7678346 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)O[C@H](C)C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O5S/c1-6(10(12)14)18-11(15)7-3-4-9(19-2)8(5-7)13(16)17/h3-6H,1-2H3,(H2,12,14)/t6-/m1/s1 |
| InChIKey | YKVZEGRHLOSLOK-ZCFIWIBFSA-N |
| XLogP | 1.35 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|