C20H15ClN4O4 — CID 7190133
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate (PubChem CID 7190133) has the molecular formula C20H15ClN4O4 and a molecular weight of 410.82 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7190133 |
| Molecular Formula | C20H15ClN4O4 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCn1nc(C(=O)OCC(=O)Nc2cc(Cl)ccc2C#N)c2ccccc2c1=O |
| InChI | InChI=1S/C20H15ClN4O4/c1-2-25-19(27)15-6-4-3-5-14(15)18(24-25)20(28)29-11-17(26)23-16-9-13(21)8-7-12(16)10-22/h3-9H,2,11H2,1H3,(H,23,26) |
| InChIKey | PSHOMCLKVAIVJK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |