C25H22N4O2S — CID 46806484
4-[[2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]benzamide (PubChem CID 46806484) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[[2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 46806484 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-[[2-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]benzamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cnc2SCC(=O)Nc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C25H22N4O2S/c1-17-7-13-21(14-8-17)29-22(18-5-3-2-4-6-18)15-27-25(29)32-16-23(30)28-20-11-9-19(10-12-20)24(26)31/h2-15H,16H2,1H3,(H2,26,31)(H,28,30) |
| InChIKey | QMBYGFMEXTYTRY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |