C20H21N5O5S2 — CID 162647479
N-morpholin-4-yl-2-[4-oxo-3-(4-sulfamoylphenyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 162647479) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-morpholin-4-yl-2-[4-oxo-3-(4-sulfamoylphenyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-morpholin-4-yl-2-[4-oxo-3-(4-sulfamoylphenyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 162647479 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-morpholin-4-yl-2-[4-oxo-3-(4-sulfamoylphenyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | NS(=O)(=O)c1ccc(-n2c(SCC(=O)NN3CCOCC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H21N5O5S2/c21-32(28,29)15-7-5-14(6-8-15)25-19(27)16-3-1-2-4-17(16)22-20(25)31-13-18(26)23-24-9-11-30-12-10-24/h1-8H,9-13H2,(H,23,26)(H2,21,28,29) |
| InChIKey | FFKHEJCPMMPYMC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |