C18H17N5O3S — CID 25410473
4-[[2-(3-amino-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]-N-methylbenzamide (PubChem CID 25410473) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-[[2-(3-amino-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-(3-amino-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 25410473 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[[2-(3-amino-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2N)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-20-16(25)11-6-8-12(9-7-11)21-15(24)10-27-18-22-14-5-3-2-4-13(14)17(26)23(18)19/h2-9H,10,19H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | VKNKGNZRIYAYRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |