C18H13N3O3S — CID 3289330
2-[(3-methyl-4-oxoquinazolin-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 3289330) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-[(3-methyl-4-oxoquinazolin-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-methyl-4-oxoquinazolin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3289330 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[(3-methyl-4-oxoquinazolin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | Cn1c(SCN2C(=O)c3ccccc3C2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H13N3O3S/c1-20-15(22)13-8-4-5-9-14(13)19-18(20)25-10-21-16(23)11-6-2-3-7-12(11)17(21)24/h2-9H,10H2,1H3 |
| InChIKey | ZLCVHKAISRLKPU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|