C29H32N4OS — CID 42734300
N-(3,3-diphenylpropyl)-4-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 42734300) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(3,3-diphenylpropyl)-4-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42734300 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | Cc1ccc(-n2c(C)nnc2SCCCC(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4OS/c1-22-15-17-26(18-16-22)33-23(2)31-32-29(33)35-21-9-14-28(34)30-20-19-27(24-10-5-3-6-11-24)25-12-7-4-8-13-25/h3-8,10-13,15-18,27H,9,14,19-21H2,1-2H3,(H,30,34) |
| InChIKey | IRRBQUVPKWQMTH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|