C25H28N4OS — CID 24557013
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide (PubChem CID 24557013) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 24557013 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide |
| SMILES | C=CCn1c(SC(C(=O)Nc2ccccc2)c2ccccc2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C25H28N4OS/c1-2-18-29-23(20-14-8-4-9-15-20)27-28-25(29)31-22(19-12-6-3-7-13-19)24(30)26-21-16-10-5-11-17-21/h2-3,5-7,10-13,16-17,20,22H,1,4,8-9,14-15,18H2,(H,26,30) |
| InChIKey | VRZNZUHUHOJQHT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|