C21H26N4OS — CID 75856525
2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenyl-1-piperidin-1-ylethanone (PubChem CID 75856525) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 75856525 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenyl-1-piperidin-1-ylethanone |
| SMILES | C=CCn1c(SC(C(=O)N2CCCCC2)c2ccccc2)nnc1C1CC1 |
| InChI | InChI=1S/C21H26N4OS/c1-2-13-25-19(17-11-12-17)22-23-21(25)27-18(16-9-5-3-6-10-16)20(26)24-14-7-4-8-15-24/h2-3,5-6,9-10,17-18H,1,4,7-8,11-15H2 |
| InChIKey | KMQKQJFSCTVCPR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|