C27H32N4OS — CID 16502653
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide (PubChem CID 16502653) has the molecular formula C27H32N4OS and a molecular weight of 460.65 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 16502653 |
| Molecular Formula | C27H32N4OS |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide |
| SMILES | C=CCn1c(SC(C(=O)Nc2cc(C)ccc2C)c2ccccc2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C27H32N4OS/c1-4-17-31-25(22-13-9-6-10-14-22)29-30-27(31)33-24(21-11-7-5-8-12-21)26(32)28-23-18-19(2)15-16-20(23)3/h4-5,7-8,11-12,15-16,18,22,24H,1,6,9-10,13-14,17H2,2-3H3,(H,28,32) |
| InChIKey | USNSZOWVBMSCKB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|