C21H29N7OS — CID 17449068
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (PubChem CID 17449068) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17449068 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| SMILES | C=CCn1c(SCC(=O)N2CCN(c3ncccn3)CC2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C21H29N7OS/c1-2-11-28-19(17-7-4-3-5-8-17)24-25-21(28)30-16-18(29)26-12-14-27(15-13-26)20-22-9-6-10-23-20/h2,6,9-10,17H,1,3-5,7-8,11-16H2 |
| InChIKey | QPYHOWWKDCKUQN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|