C26H24N4OS — CID 55665023
2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide (PubChem CID 55665023) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide.
| Compound Name | 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 55665023 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N,2-diphenylacetamide |
| SMILES | C=CCn1c(Cc2ccccc2)nnc1SC(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24N4OS/c1-2-18-30-23(19-20-12-6-3-7-13-20)28-29-26(30)32-24(21-14-8-4-9-15-21)25(31)27-22-16-10-5-11-17-22/h2-17,24H,1,18-19H2,(H,27,31) |
| InChIKey | WWEAUVXJGNDZQG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|