C21H21N3OS — CID 55665187
2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylpropan-1-one (PubChem CID 55665187) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylpropan-1-one.
| Compound Name | 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 55665187 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-[(5-benzyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylpropan-1-one |
| SMILES | C=CCn1c(Cc2ccccc2)nnc1SC(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N3OS/c1-3-14-24-19(15-17-10-6-4-7-11-17)22-23-21(24)26-16(2)20(25)18-12-8-5-9-13-18/h3-13,16H,1,14-15H2,2H3 |
| InChIKey | RTSOVQAIZIDQNE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|