C16H27N5OS — CID 126447723
(2S)-N-ethyl-N-methyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 126447723) has the molecular formula C16H27N5OS and a molecular weight of 337.49 g/mol. Its IUPAC name is (2S)-N-ethyl-N-methyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-ethyl-N-methyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 126447723 |
| Molecular Formula | C16H27N5OS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-N-ethyl-N-methyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)N(C)CC)nnc1C1CCNCC1 |
| InChI | InChI=1S/C16H27N5OS/c1-5-11-21-14(13-7-9-17-10-8-13)18-19-16(21)23-12(3)15(22)20(4)6-2/h5,12-13,17H,1,6-11H2,2-4H3/t12-/m0/s1 |
| InChIKey | YVOFBITXORYKSD-LBPRGKRZSA-N |
| XLogP | 1.89 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|