C21H27ClN4OS — CID 8887943
(2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-cycloheptylpropanamide (PubChem CID 8887943) has the molecular formula C21H27ClN4OS and a molecular weight of 418.99 g/mol. Its IUPAC name is (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-cycloheptylpropanamide.
| Compound Name | (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-cycloheptylpropanamide |
|---|---|
| PubChem CID | 8887943 |
| Molecular Formula | C21H27ClN4OS |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-cycloheptylpropanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)NC2CCCCCC2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN4OS/c1-3-14-26-19(16-10-12-17(22)13-11-16)24-25-21(26)28-15(2)20(27)23-18-8-6-4-5-7-9-18/h3,10-13,15,18H,1,4-9,14H2,2H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | HMIBKXIPJAXIQH-OAHLLOKOSA-N |
| XLogP | 5.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|