C25H30FN5O2S — CID 112771192
N-(1-adamantylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 112771192) has the molecular formula C25H30FN5O2S and a molecular weight of 483.61 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 112771192 |
| Molecular Formula | C25H30FN5O2S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NC(=O)NC23CC4CC(CC(C4)C2)C3)nnc1-c1ccccc1F |
| InChI | InChI=1S/C25H30FN5O2S/c1-3-8-31-21(19-6-4-5-7-20(19)26)29-30-24(31)34-15(2)22(32)27-23(33)28-25-12-16-9-17(13-25)11-18(10-16)14-25/h3-7,15-18H,1,8-14H2,2H3,(H2,27,28,32,33) |
| InChIKey | SLPCFZVURDAWFG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|